2-Amino-4-methylthiazole-5-carboxylic acid
Catalog No: FT-0646472
CAS No: 67899-00-7
- Chemical Name: 2-Amino-4-methylthiazole-5-carboxylic acid
- Molecular Formula: C5H6N2O2S
- Molecular Weight: 158.18
- InChI Key: QCVFVGONDMKXEE-UHFFFAOYSA-N
- InChI: InChI=1S/C5H6N2O2S/c1-2-3(4(8)9)10-5(6)7-2/h1H3,(H2,6,7)(H,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 158.178 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 67899-00-7 |
| Bolling_Point: | 400.6±25.0 °C at 760 mmHg |
| Product_Name: | 2-Amino-4-methyl-1,3-thiazole-5-carboxylic acid |
| Melting_Point: | N/A |
| Flash_Point: | 196.1±23.2 °C |
| MF: | C5H6N2O2S |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 0.52 |
| Flash_Point: | 196.1±23.2 °C |
| Refractive_Index: | 1.674 |
| FW: | 158.178 |
| PSA: | 104.45000 |
| MF: | C5H6N2O2S |
| Bolling_Point: | 400.6±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Exact_Mass: | 158.014999 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934100090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)